C22H28FN5O — CID 166601787
2-[4-[(5-fluoro-3-pyridinyl)methyl]piperazin-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 166601787) has the molecular formula C22H28FN5O and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[4-[(5-fluoro-3-pyridinyl)methyl]piperazin-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-[(5-fluoro-3-pyridinyl)methyl]piperazin-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 166601787 |
| Molecular Formula | C22H28FN5O |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-[4-[(5-fluoro-3-pyridinyl)methyl]piperazin-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(Cc2cncc(F)c2)CC1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28FN5O/c23-20-14-19(15-24-16-20)17-25-6-8-26(9-7-25)18-22(29)28-12-10-27(11-13-28)21-4-2-1-3-5-21/h1-5,14-16H,6-13,17-18H2 |
| InChIKey | RXZCSDDYQKYLKI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 42.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |