C24H33N7O — CID 154830256
1-(4-phenylpiperazin-1-yl)-2-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]ethanone (PubChem CID 154830256) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is 1-(4-phenylpiperazin-1-yl)-2-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-(4-phenylpiperazin-1-yl)-2-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 154830256 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 1-(4-phenylpiperazin-1-yl)-2-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2cc(N3CCCC3)ncn2)CC1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N7O/c32-24(31-16-14-28(15-17-31)21-6-2-1-3-7-21)19-27-10-12-30(13-11-27)23-18-22(25-20-26-23)29-8-4-5-9-29/h1-3,6-7,18,20H,4-5,8-17,19H2 |
| InChIKey | MIKQJXUUVBIQSD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |