C23H30N8O — CID 163345167
2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 163345167) has the molecular formula C23H30N8O and a molecular weight of 434.55 g/mol. Its IUPAC name is 2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 163345167 |
| Molecular Formula | C23H30N8O |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | CCn1cnc2c(N3CCN(CC(=O)N4CCN(c5ccccc5)CC4)CC3)ncnc21 |
| InChI | InChI=1S/C23H30N8O/c1-2-28-18-26-21-22(28)24-17-25-23(21)31-10-8-27(9-11-31)16-20(32)30-14-12-29(13-15-30)19-6-4-3-5-7-19/h3-7,17-18H,2,8-16H2,1H3 |
| InChIKey | KJYZMZGMMCBUFS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 73.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |