C14H20N6O2 — CID 166601299
1-[4-[9-(2-methoxyethyl)purin-6-yl]piperazin-1-yl]ethanone (PubChem CID 166601299) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[4-[9-(2-methoxyethyl)purin-6-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[9-(2-methoxyethyl)purin-6-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 166601299 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-[4-[9-(2-methoxyethyl)purin-6-yl]piperazin-1-yl]ethanone |
| SMILES | COCCn1cnc2c(N3CCN(C(C)=O)CC3)ncnc21 |
| InChI | InChI=1S/C14H20N6O2/c1-11(21)18-3-5-19(6-4-18)13-12-14(16-9-15-13)20(10-17-12)7-8-22-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | ZMSDDQDUWWKFFK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |