C18H21FN6O — CID 154829257
6-[4-(4-fluorophenyl)piperazin-1-yl]-9-(2-methoxyethyl)purine (PubChem CID 154829257) has the molecular formula C18H21FN6O and a molecular weight of 356.41 g/mol. Its IUPAC name is 6-[4-(4-fluorophenyl)piperazin-1-yl]-9-(2-methoxyethyl)purine.
| Compound Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]-9-(2-methoxyethyl)purine |
|---|---|
| PubChem CID | 154829257 |
| Molecular Formula | C18H21FN6O |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]-9-(2-methoxyethyl)purine |
| SMILES | COCCn1cnc2c(N3CCN(c4ccc(F)cc4)CC3)ncnc21 |
| InChI | InChI=1S/C18H21FN6O/c1-26-11-10-25-13-22-16-17(20-12-21-18(16)25)24-8-6-23(7-9-24)15-4-2-14(19)3-5-15/h2-5,12-13H,6-11H2,1H3 |
| InChIKey | YEGKBPPXLMTYOE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |