C17H24N6O3S — CID 155798991
6-(5-cyclopropylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-9-(2-methoxyethyl)purine (PubChem CID 155798991) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is 6-(5-cyclopropylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-9-(2-methoxyethyl)purine.
| Compound Name | 6-(5-cyclopropylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-9-(2-methoxyethyl)purine |
|---|---|
| PubChem CID | 155798991 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 6-(5-cyclopropylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-9-(2-methoxyethyl)purine |
| SMILES | COCCn1cnc2c(N3CC4CN(S(=O)(=O)C5CC5)CC4C3)ncnc21 |
| InChI | InChI=1S/C17H24N6O3S/c1-26-5-4-21-11-20-15-16(21)18-10-19-17(15)22-6-12-8-23(9-13(12)7-22)27(24,25)14-2-3-14/h10-14H,2-9H2,1H3 |
| InChIKey | GCKOCERJLAQKFR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |