C20H22F3N7O — CID 155975112
9-(2-methoxyethyl)-6-[2-[2-(trifluoromethyl)-4-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]purine (PubChem CID 155975112) has the molecular formula C20H22F3N7O and a molecular weight of 433.44 g/mol. Its IUPAC name is 9-(2-methoxyethyl)-6-[2-[2-(trifluoromethyl)-4-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]purine.
| Compound Name | 9-(2-methoxyethyl)-6-[2-[2-(trifluoromethyl)-4-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]purine |
|---|---|
| PubChem CID | 155975112 |
| Molecular Formula | C20H22F3N7O |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 9-(2-methoxyethyl)-6-[2-[2-(trifluoromethyl)-4-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]purine |
| SMILES | COCCn1cnc2c(N3CC4CN(c5ccnc(C(F)(F)F)c5)CC4C3)ncnc21 |
| InChI | InChI=1S/C20H22F3N7O/c1-31-5-4-28-12-27-17-18(28)25-11-26-19(17)30-9-13-7-29(8-14(13)10-30)15-2-3-24-16(6-15)20(21,22)23/h2-3,6,11-14H,4-5,7-10H2,1H3 |
| InChIKey | MSDOOIKNNJMXCJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |