C20H22FN7O2 — CID 155799370
(3-fluoro-2-pyridinyl)-[2-[9-(2-methoxyethyl)purin-6-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 155799370) has the molecular formula C20H22FN7O2 and a molecular weight of 411.44 g/mol. Its IUPAC name is (3-fluoro-2-pyridinyl)-[2-[9-(2-methoxyethyl)purin-6-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (3-fluoro-2-pyridinyl)-[2-[9-(2-methoxyethyl)purin-6-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 155799370 |
| Molecular Formula | C20H22FN7O2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (3-fluoro-2-pyridinyl)-[2-[9-(2-methoxyethyl)purin-6-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | COCCn1cnc2c(N3CC4CN(C(=O)c5ncccc5F)CC4C3)ncnc21 |
| InChI | InChI=1S/C20H22FN7O2/c1-30-6-5-26-12-25-17-18(26)23-11-24-19(17)27-7-13-9-28(10-14(13)8-27)20(29)16-15(21)3-2-4-22-16/h2-4,11-14H,5-10H2,1H3 |
| InChIKey | HAJKBJZUAOZPSJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |