C21H26N6O2S — CID 155977133
9-ethyl-6-[5-(2-phenylethylsulfonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]purine (PubChem CID 155977133) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 9-ethyl-6-[5-(2-phenylethylsulfonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]purine.
| Compound Name | 9-ethyl-6-[5-(2-phenylethylsulfonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]purine |
|---|---|
| PubChem CID | 155977133 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 9-ethyl-6-[5-(2-phenylethylsulfonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]purine |
| SMILES | CCn1cnc2c(N3CC4CN(S(=O)(=O)CCc5ccccc5)CC4C3)ncnc21 |
| InChI | InChI=1S/C21H26N6O2S/c1-2-25-15-24-19-20(25)22-14-23-21(19)26-10-17-12-27(13-18(17)11-26)30(28,29)9-8-16-6-4-3-5-7-16/h3-7,14-15,17-18H,2,8-13H2,1H3 |
| InChIKey | IJQPWBXWNHBEAQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |