C19H20N8 — CID 155980586
6-[5-(9-ethylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile (PubChem CID 155980586) has the molecular formula C19H20N8 and a molecular weight of 360.43 g/mol. Its IUPAC name is 6-[5-(9-ethylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[5-(9-ethylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155980586 |
| Molecular Formula | C19H20N8 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 6-[5-(9-ethylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile |
| SMILES | CCn1cnc2c(N3CC4CN(c5ccc(C#N)cn5)CC4C3)ncnc21 |
| InChI | InChI=1S/C19H20N8/c1-2-25-12-24-17-18(25)22-11-23-19(17)27-9-14-7-26(8-15(14)10-27)16-4-3-13(5-20)6-21-16/h3-4,6,11-12,14-15H,2,7-10H2,1H3 |
| InChIKey | RFVGWXJNAIFFNL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |