C18H18N8 — CID 155980578
6-[4-(9-cyclopropylpurin-6-yl)piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 155980578) has the molecular formula C18H18N8 and a molecular weight of 346.40 g/mol. Its IUPAC name is 6-[4-(9-cyclopropylpurin-6-yl)piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(9-cyclopropylpurin-6-yl)piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155980578 |
| Molecular Formula | C18H18N8 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 6-[4-(9-cyclopropylpurin-6-yl)piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(c3ncnc4c3ncn4C3CC3)CC2)nc1 |
| InChI | InChI=1S/C18H18N8/c19-9-13-1-4-15(20-10-13)24-5-7-25(8-6-24)17-16-18(22-11-21-17)26(12-23-16)14-2-3-14/h1,4,10-12,14H,2-3,5-8H2 |
| InChIKey | XLJRMVOWZBYHMN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |