C22H28N6O2 — CID 167818272
4-[4-[9-[4-(hydroxymethyl)cyclohexyl]purin-6-yl]piperazin-1-yl]phenol (PubChem CID 167818272) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 4-[4-[9-[4-(hydroxymethyl)cyclohexyl]purin-6-yl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[9-[4-(hydroxymethyl)cyclohexyl]purin-6-yl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 167818272 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 4-[4-[9-[4-(hydroxymethyl)cyclohexyl]purin-6-yl]piperazin-1-yl]phenol |
| SMILES | OCC1CCC(n2cnc3c(N4CCN(c5ccc(O)cc5)CC4)ncnc32)CC1 |
| InChI | InChI=1S/C22H28N6O2/c29-13-16-1-3-18(4-2-16)28-15-25-20-21(23-14-24-22(20)28)27-11-9-26(10-12-27)17-5-7-19(30)8-6-17/h5-8,14-16,18,29-30H,1-4,9-13H2 |
| InChIKey | CGLNZTSFJUMGHD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |