C18H20N4O2 — CID 136506485
4-[3-[4-(hydroxymethyl)cyclohexyl]imidazo[4,5-b]pyrazin-5-yl]phenol (PubChem CID 136506485) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[3-[4-(hydroxymethyl)cyclohexyl]imidazo[4,5-b]pyrazin-5-yl]phenol.
| Compound Name | 4-[3-[4-(hydroxymethyl)cyclohexyl]imidazo[4,5-b]pyrazin-5-yl]phenol |
|---|---|
| PubChem CID | 136506485 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[3-[4-(hydroxymethyl)cyclohexyl]imidazo[4,5-b]pyrazin-5-yl]phenol |
| SMILES | OCC1CCC(n2cnc3ncc(-c4ccc(O)cc4)nc32)CC1 |
| InChI | InChI=1S/C18H20N4O2/c23-10-12-1-5-14(6-2-12)22-11-20-17-18(22)21-16(9-19-17)13-3-7-15(24)8-4-13/h3-4,7-9,11-12,14,23-24H,1-2,5-6,10H2 |
| InChIKey | HOYCHBZYOFTAOU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |