C19H22N4O2 — CID 136506481
4-[3-[4-(methoxymethyl)cyclohexyl]imidazo[4,5-b]pyrazin-5-yl]phenol (PubChem CID 136506481) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-[3-[4-(methoxymethyl)cyclohexyl]imidazo[4,5-b]pyrazin-5-yl]phenol.
| Compound Name | 4-[3-[4-(methoxymethyl)cyclohexyl]imidazo[4,5-b]pyrazin-5-yl]phenol |
|---|---|
| PubChem CID | 136506481 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-[3-[4-(methoxymethyl)cyclohexyl]imidazo[4,5-b]pyrazin-5-yl]phenol |
| SMILES | COCC1CCC(n2cnc3ncc(-c4ccc(O)cc4)nc32)CC1 |
| InChI | InChI=1S/C19H22N4O2/c1-25-11-13-2-6-15(7-3-13)23-12-21-18-19(23)22-17(10-20-18)14-4-8-16(24)9-5-14/h4-5,8-10,12-13,15,24H,2-3,6-7,11H2,1H3 |
| InChIKey | BSPDWUKTIFTHCJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |