C16H21N3O — CID 135118040
6-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]pyridine-3-carbonitrile (PubChem CID 135118040) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 6-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135118040 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 6-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]pyridine-3-carbonitrile |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(c3ccc(C#N)cn3)C[C@@H]21 |
| InChI | InChI=1S/C16H21N3O/c1-2-16(20)7-3-4-13-10-19(11-14(13)16)15-6-5-12(8-17)9-18-15/h5-6,9,13-14,20H,2-4,7,10-11H2,1H3/t13-,14+,16-/m1/s1 |
| InChIKey | STFPXNMSJWJZMR-IJEWVQPXSA-N |
| XLogP | 2.33 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |