C17H24N2O2 — CID 135118832
1-[2-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-4-pyridinyl]ethanone (PubChem CID 135118832) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[2-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-4-pyridinyl]ethanone.
| Compound Name | 1-[2-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-4-pyridinyl]ethanone |
|---|---|
| PubChem CID | 135118832 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[2-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-4-pyridinyl]ethanone |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(c3cc(C(C)=O)ccn3)C[C@@H]21 |
| InChI | InChI=1S/C17H24N2O2/c1-3-17(21)7-4-5-14-10-19(11-15(14)17)16-9-13(12(2)20)6-8-18-16/h6,8-9,14-15,21H,3-5,7,10-11H2,1-2H3/t14-,15+,17-/m1/s1 |
| InChIKey | ICSFBDJNYSBPCW-HLLBOEOZSA-N |
| XLogP | 2.66 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |