C17H23Cl2NO — CID 166615148
(3aR,4R,7aS)-2-[(3,4-dichlorophenyl)methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 166615148) has the molecular formula C17H23Cl2NO and a molecular weight of 328.28 g/mol. Its IUPAC name is (3aR,4R,7aS)-2-[(3,4-dichlorophenyl)methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aR,4R,7aS)-2-[(3,4-dichlorophenyl)methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 166615148 |
| Molecular Formula | C17H23Cl2NO |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (3aR,4R,7aS)-2-[(3,4-dichlorophenyl)methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(Cc3ccc(Cl)c(Cl)c3)C[C@@H]21 |
| InChI | InChI=1S/C17H23Cl2NO/c1-2-17(21)7-3-4-13-10-20(11-14(13)17)9-12-5-6-15(18)16(19)8-12/h5-6,8,13-14,21H,2-4,7,9-11H2,1H3/t13-,14+,17-/m1/s1 |
| InChIKey | YCDRCDCDMLVBBS-JKIFEVAISA-N |
| XLogP | 4.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |