C15H25N3O — CID 135087494
(3aR,4R,7aS)-4-ethyl-2-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 135087494) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-ethyl-2-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aR,4R,7aS)-4-ethyl-2-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 135087494 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (3aR,4R,7aS)-4-ethyl-2-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(Cc3nccn3C)C[C@@H]21 |
| InChI | InChI=1S/C15H25N3O/c1-3-15(19)6-4-5-12-9-18(10-13(12)15)11-14-16-7-8-17(14)2/h7-8,12-13,19H,3-6,9-11H2,1-2H3/t12-,13+,15-/m1/s1 |
| InChIKey | HRVXQARWKQOFLK-VNHYZAJKSA-N |
| XLogP | 1.79 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |