C21H28N2O — CID 135114411
(3aR,4R,7aS)-4-ethyl-2-[(6-methylquinolin-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 135114411) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-ethyl-2-[(6-methylquinolin-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aR,4R,7aS)-4-ethyl-2-[(6-methylquinolin-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 135114411 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (3aR,4R,7aS)-4-ethyl-2-[(6-methylquinolin-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(Cc3c(C)ccc4ncccc34)C[C@@H]21 |
| InChI | InChI=1S/C21H28N2O/c1-3-21(24)10-4-6-16-12-23(14-19(16)21)13-18-15(2)8-9-20-17(18)7-5-11-22-20/h5,7-9,11,16,19,24H,3-4,6,10,12-14H2,1-2H3/t16-,19+,21-/m1/s1 |
| InChIKey | SXNGYLGCQJJESK-LKUPVBHCSA-N |
| XLogP | 3.92 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |