C21H29N3O — CID 135107879
[(4aS,8aS)-1-methyl-7-[(6-methylquinolin-5-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135107879) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-[(6-methylquinolin-5-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-[(6-methylquinolin-5-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135107879 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-[(6-methylquinolin-5-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | Cc1ccc2ncccc2c1CN1CC[C@@]2(CO)CCCN(C)[C@@H]2C1 |
| InChI | InChI=1S/C21H29N3O/c1-16-6-7-19-17(5-3-10-22-19)18(16)13-24-12-9-21(15-25)8-4-11-23(2)20(21)14-24/h3,5-7,10,20,25H,4,8-9,11-15H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | VIPUSMUVSXZBIS-NHCUHLMSSA-N |
| XLogP | 2.82 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |