C22H29N3O — CID 135113762
[(4aS,8aS)-1-methyl-7-[(4-pyridin-3-ylphenyl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135113762) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-[(4-pyridin-3-ylphenyl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-[(4-pyridin-3-ylphenyl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135113762 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-[(4-pyridin-3-ylphenyl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CN1CCC[C@]2(CO)CCN(Cc3ccc(-c4cccnc4)cc3)C[C@@H]12 |
| InChI | InChI=1S/C22H29N3O/c1-24-12-3-9-22(17-26)10-13-25(16-21(22)24)15-18-5-7-19(8-6-18)20-4-2-11-23-14-20/h2,4-8,11,14,21,26H,3,9-10,12-13,15-17H2,1H3/t21-,22-/m1/s1 |
| InChIKey | PQCSYUWQMOEKGW-FGZHOGPDSA-N |
| XLogP | 3.03 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |