C21H32N2O — CID 135113968
[(4aS,8aS)-1-methyl-7-[(E)-2-phenylpent-2-enyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135113968) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-[(E)-2-phenylpent-2-enyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-[(E)-2-phenylpent-2-enyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135113968 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-[(E)-2-phenylpent-2-enyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CC/C=C(/CN1CC[C@@]2(CO)CCCN(C)[C@@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C21H32N2O/c1-3-8-19(18-9-5-4-6-10-18)15-23-14-12-21(17-24)11-7-13-22(2)20(21)16-23/h4-6,8-10,20,24H,3,7,11-17H2,1-2H3/b19-8-/t20-,21-/m1/s1 |
| InChIKey | HCIISDJHAGCBCW-MNTAORQDSA-N |
| XLogP | 3.26 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |