C19H32N2OS — CID 135118141
[(4aS,8aS)-1-methyl-7-[[5-(2-methylpropyl)thiophen-2-yl]methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135118141) has the molecular formula C19H32N2OS and a molecular weight of 336.55 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-[[5-(2-methylpropyl)thiophen-2-yl]methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-[[5-(2-methylpropyl)thiophen-2-yl]methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135118141 |
| Molecular Formula | C19H32N2OS |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-[[5-(2-methylpropyl)thiophen-2-yl]methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CC(C)Cc1ccc(CN2CC[C@@]3(CO)CCCN(C)[C@@H]3C2)s1 |
| InChI | InChI=1S/C19H32N2OS/c1-15(2)11-16-5-6-17(23-16)12-21-10-8-19(14-22)7-4-9-20(3)18(19)13-21/h5-6,15,18,22H,4,7-14H2,1-3H3/t18-,19-/m1/s1 |
| InChIKey | SJQBHTJKZVCDRN-RTBURBONSA-N |
| XLogP | 3.23 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |