C21H30N4O — CID 135102042
[(4aS,8aS)-1-methyl-7-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135102042) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135102042 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | Cc1nn(-c2ccccc2)cc1CN1CC[C@@]2(CO)CCCN(C)[C@@H]2C1 |
| InChI | InChI=1S/C21H30N4O/c1-17-18(14-25(22-17)19-7-4-3-5-8-19)13-24-12-10-21(16-26)9-6-11-23(2)20(21)15-24/h3-5,7-8,14,20,26H,6,9-13,15-16H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | GLMXCMMYCUTYEO-NHCUHLMSSA-N |
| XLogP | 2.46 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |