C20H31NO2 — CID 135118471
(3aR,4R,7aS)-4-ethyl-2-[(4-propoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 135118471) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-ethyl-2-[(4-propoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aR,4R,7aS)-4-ethyl-2-[(4-propoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 135118471 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (3aR,4R,7aS)-4-ethyl-2-[(4-propoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CCCOc1ccc(CN2C[C@H]3CCC[C@](O)(CC)[C@H]3C2)cc1 |
| InChI | InChI=1S/C20H31NO2/c1-3-12-23-18-9-7-16(8-10-18)13-21-14-17-6-5-11-20(22,4-2)19(17)15-21/h7-10,17,19,22H,3-6,11-15H2,1-2H3/t17-,19+,20-/m1/s1 |
| InChIKey | MVLVXKSITUWSRW-YZGWKJHDSA-N |
| XLogP | 3.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |