C21H32ClNO3 — CID 163319130
(3aS,4S,7aR)-2-[(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 163319130) has the molecular formula C21H32ClNO3 and a molecular weight of 381.94 g/mol. Its IUPAC name is (3aS,4S,7aR)-2-[(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aS,4S,7aR)-2-[(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 163319130 |
| Molecular Formula | C21H32ClNO3 |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (3aS,4S,7aR)-2-[(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CC[C@]1(O)CCC[C@H]2CN(Cc3cc(Cl)cc(OC)c3OC(C)C)C[C@H]21 |
| InChI | InChI=1S/C21H32ClNO3/c1-5-21(24)8-6-7-15-11-23(13-18(15)21)12-16-9-17(22)10-19(25-4)20(16)26-14(2)3/h9-10,14-15,18,24H,5-8,11-13H2,1-4H3/t15-,18+,21-/m0/s1 |
| InChIKey | MIPQDTPDVHQIAF-KLHJMIIUSA-N |
| XLogP | 4.51 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |