C18H24ClNO3 — CID 135111944
[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(3-chloro-5-methoxyphenyl)methanone (PubChem CID 135111944) has the molecular formula C18H24ClNO3 and a molecular weight of 337.85 g/mol. Its IUPAC name is [(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(3-chloro-5-methoxyphenyl)methanone.
| Compound Name | [(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(3-chloro-5-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 135111944 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(3-chloro-5-methoxyphenyl)methanone |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(C(=O)c3cc(Cl)cc(OC)c3)C[C@@H]21 |
| InChI | InChI=1S/C18H24ClNO3/c1-3-18(22)6-4-5-12-10-20(11-16(12)18)17(21)13-7-14(19)9-15(8-13)23-2/h7-9,12,16,22H,3-6,10-11H2,1-2H3/t12-,16+,18-/m1/s1 |
| InChIKey | CUFNCGDJRVPNLM-PZPSRYQVSA-N |
| XLogP | 3.36 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |