C18H26N2O2 — CID 162635920
[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1-cyclopropylpyrrol-2-yl)methanone (PubChem CID 162635920) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1-cyclopropylpyrrol-2-yl)methanone.
| Compound Name | [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1-cyclopropylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 162635920 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1-cyclopropylpyrrol-2-yl)methanone |
| SMILES | CC[C@]1(O)CCC[C@H]2CN(C(=O)c3cccn3C3CC3)C[C@H]21 |
| InChI | InChI=1S/C18H26N2O2/c1-2-18(22)9-3-5-13-11-19(12-15(13)18)17(21)16-6-4-10-20(16)14-7-8-14/h4,6,10,13-15,22H,2-3,5,7-9,11-12H2,1H3/t13-,15+,18-/m0/s1 |
| InChIKey | HFMFIJIBZGIMSP-JOQOYGCGSA-N |
| XLogP | 2.84 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |