C19H28N2O2 — CID 135114615
(3aS,7R,7aR)-7-ethyl-N-(2-ethylphenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxamide (PubChem CID 135114615) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3aS,7R,7aR)-7-ethyl-N-(2-ethylphenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxamide.
| Compound Name | (3aS,7R,7aR)-7-ethyl-N-(2-ethylphenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxamide |
|---|---|
| PubChem CID | 135114615 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (3aS,7R,7aR)-7-ethyl-N-(2-ethylphenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxamide |
| SMILES | CCc1ccccc1NC(=O)N1C[C@H]2CCC[C@](O)(CC)[C@H]2C1 |
| InChI | InChI=1S/C19H28N2O2/c1-3-14-8-5-6-10-17(14)20-18(22)21-12-15-9-7-11-19(23,4-2)16(15)13-21/h5-6,8,10,15-16,23H,3-4,7,9,11-13H2,1-2H3,(H,20,22)/t15-,16+,19-/m1/s1 |
| InChIKey | BSZVGVXKMBERCA-JTDSTZFVSA-N |
| XLogP | 3.65 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |