C19H28N2O3 — CID 135090676
(3aS,7R,7aR)-N-(2-ethoxyphenyl)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxamide (PubChem CID 135090676) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (3aS,7R,7aR)-N-(2-ethoxyphenyl)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxamide.
| Compound Name | (3aS,7R,7aR)-N-(2-ethoxyphenyl)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxamide |
|---|---|
| PubChem CID | 135090676 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (3aS,7R,7aR)-N-(2-ethoxyphenyl)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)N1C[C@H]2CCC[C@](O)(CC)[C@H]2C1 |
| InChI | InChI=1S/C19H28N2O3/c1-3-19(23)11-7-8-14-12-21(13-15(14)19)18(22)20-16-9-5-6-10-17(16)24-4-2/h5-6,9-10,14-15,23H,3-4,7-8,11-13H2,1-2H3,(H,20,22)/t14-,15+,19-/m1/s1 |
| InChIKey | MNEALAYNKQZZBP-ZRGWGRIASA-N |
| XLogP | 3.49 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |