C23H28N2O — CID 95284375
(4aS,8aR)-N-(2-benzylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide (PubChem CID 95284375) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (4aS,8aR)-N-(2-benzylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide.
| Compound Name | (4aS,8aR)-N-(2-benzylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 95284375 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (4aS,8aR)-N-(2-benzylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Cc1ccccc1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C23H28N2O/c26-23(25-15-14-19-10-4-5-12-21(19)17-25)24-22-13-7-6-11-20(22)16-18-8-2-1-3-9-18/h1-3,6-9,11,13,19,21H,4-5,10,12,14-17H2,(H,24,26)/t19-,21-/m0/s1 |
| InChIKey | MJXBEALCCAKSCJ-FPOVZHCZSA-N |
| XLogP | 5.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |