C21H29NO2 — CID 159313344
1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-6-phenylhexane-1,5-dione (PubChem CID 159313344) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-6-phenylhexane-1,5-dione.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-6-phenylhexane-1,5-dione |
|---|---|
| PubChem CID | 159313344 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-6-phenylhexane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCC2CCCCC2C1)Cc1ccccc1 |
| InChI | InChI=1S/C21H29NO2/c23-20(15-17-7-2-1-3-8-17)11-6-12-21(24)22-14-13-18-9-4-5-10-19(18)16-22/h1-3,7-8,18-19H,4-6,9-16H2 |
| InChIKey | LCVCLQYAQOXULK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |