C20H27NO3 — CID 67757796
4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-benzyl-4-oxobutanoic acid (PubChem CID 67757796) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-benzyl-4-oxobutanoic acid.
| Compound Name | 4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-benzyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67757796 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-benzyl-4-oxobutanoic acid |
| SMILES | O=C(O)C(CC(=O)N1CC[C@H]2CCCC[C@@H]2C1)Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO3/c22-19(21-11-10-16-8-4-5-9-17(16)14-21)13-18(20(23)24)12-15-6-2-1-3-7-15/h1-3,6-7,16-18H,4-5,8-14H2,(H,23,24)/t16-,17-,18?/m1/s1 |
| InChIKey | IZSBWGCEVVPDMW-OWZOALSMSA-N |
| XLogP | 3.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |