C25H29NO3 — CID 9229270
[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl] 2,2-diphenylacetate (PubChem CID 9229270) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl] 2,2-diphenylacetate.
| Compound Name | [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 9229270 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl] 2,2-diphenylacetate |
| SMILES | O=C(OCC(=O)N1CC[C@@H]2CCCC[C@@H]2C1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NO3/c27-23(26-16-15-19-9-7-8-14-22(19)17-26)18-29-25(28)24(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-6,10-13,19,22,24H,7-9,14-18H2/t19-,22+/m0/s1 |
| InChIKey | ZLKWKEGFXGZQGQ-SIKLNZKXSA-N |
| XLogP | 4.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |