C17H24N2O — CID 104897194
(2S)-1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-amino-2-phenylethanone (PubChem CID 104897194) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (2S)-1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-amino-2-phenylethanone.
| Compound Name | (2S)-1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-amino-2-phenylethanone |
|---|---|
| PubChem CID | 104897194 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (2S)-1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-amino-2-phenylethanone |
| SMILES | N[C@H](C(=O)N1CCC2CCCCC2C1)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O/c18-16(14-7-2-1-3-8-14)17(20)19-11-10-13-6-4-5-9-15(13)12-19/h1-3,7-8,13,15-16H,4-6,9-12,18H2/t13?,15?,16-/m0/s1 |
| InChIKey | QZMJLZIPOYEJTC-BCLQGDPASA-N |
| XLogP | 2.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |