C28H37N3OS — CID 87154026
1-[5-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-oxopentyl]-3-benzhydrylthiourea (PubChem CID 87154026) has the molecular formula C28H37N3OS and a molecular weight of 463.69 g/mol. Its IUPAC name is 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-oxopentyl]-3-benzhydrylthiourea.
| Compound Name | 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-oxopentyl]-3-benzhydrylthiourea |
|---|---|
| PubChem CID | 87154026 |
| Molecular Formula | C28H37N3OS |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-oxopentyl]-3-benzhydrylthiourea |
| SMILES | O=C(CCCCNC(=S)NC(c1ccccc1)c1ccccc1)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C28H37N3OS/c32-26(31-20-18-22-11-7-8-16-25(22)21-31)17-9-10-19-29-28(33)30-27(23-12-3-1-4-13-23)24-14-5-2-6-15-24/h1-6,12-15,22,25,27H,7-11,16-21H2,(H2,29,30,33) |
| InChIKey | BBRXMZKFKOOAGC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|