C22H27NO2 — CID 9108423
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(5-phenylfuran-2-yl)propan-1-one (PubChem CID 9108423) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(5-phenylfuran-2-yl)propan-1-one.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(5-phenylfuran-2-yl)propan-1-one |
|---|---|
| PubChem CID | 9108423 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(5-phenylfuran-2-yl)propan-1-one |
| SMILES | O=C(CCc1ccc(-c2ccccc2)o1)N1CC[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C22H27NO2/c24-22(23-15-14-17-6-4-5-9-19(17)16-23)13-11-20-10-12-21(25-20)18-7-2-1-3-8-18/h1-3,7-8,10,12,17,19H,4-6,9,11,13-16H2/t17-,19+/m1/s1 |
| InChIKey | LZIRJKRXAAUVDB-MJGOQNOKSA-N |
| XLogP | 4.92 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |