C18H19NO5 — CID 124703973
(2R)-4-[3-(5-phenylfuran-2-yl)propanoyl]morpholine-2-carboxylic acid (PubChem CID 124703973) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is (2R)-4-[3-(5-phenylfuran-2-yl)propanoyl]morpholine-2-carboxylic acid.
| Compound Name | (2R)-4-[3-(5-phenylfuran-2-yl)propanoyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 124703973 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (2R)-4-[3-(5-phenylfuran-2-yl)propanoyl]morpholine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)CCc2ccc(-c3ccccc3)o2)CCO1 |
| InChI | InChI=1S/C18H19NO5/c20-17(19-10-11-23-16(12-19)18(21)22)9-7-14-6-8-15(24-14)13-4-2-1-3-5-13/h1-6,8,16H,7,9-12H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | FIXQSKKRVJTEBY-MRXNPFEDSA-N |
| XLogP | 2.19 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |