C19H28N4O3 — CID 162633173
[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-morpholin-4-ylpyrimidin-5-yl)methanone (PubChem CID 162633173) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-morpholin-4-ylpyrimidin-5-yl)methanone.
| Compound Name | [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-morpholin-4-ylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 162633173 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-morpholin-4-ylpyrimidin-5-yl)methanone |
| SMILES | CC[C@]1(O)CCC[C@H]2CN(C(=O)c3cnc(N4CCOCC4)nc3)C[C@H]21 |
| InChI | InChI=1S/C19H28N4O3/c1-2-19(25)5-3-4-14-12-23(13-16(14)19)17(24)15-10-20-18(21-11-15)22-6-8-26-9-7-22/h10-11,14,16,25H,2-9,12-13H2,1H3/t14-,16+,19-/m0/s1 |
| InChIKey | AXWNXOWGTIBZAH-GMBSWORKSA-N |
| XLogP | 1.33 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |