C19H24N2O3 — CID 162627762
[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-methyl-1,3-benzoxazol-6-yl)methanone (PubChem CID 162627762) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-methyl-1,3-benzoxazol-6-yl)methanone.
| Compound Name | [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-methyl-1,3-benzoxazol-6-yl)methanone |
|---|---|
| PubChem CID | 162627762 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-methyl-1,3-benzoxazol-6-yl)methanone |
| SMILES | CC[C@]1(O)CCC[C@H]2CN(C(=O)c3ccc4nc(C)oc4c3)C[C@H]21 |
| InChI | InChI=1S/C19H24N2O3/c1-3-19(23)8-4-5-14-10-21(11-15(14)19)18(22)13-6-7-16-17(9-13)24-12(2)20-16/h6-7,9,14-15,23H,3-5,8,10-11H2,1-2H3/t14-,15+,19-/m0/s1 |
| InChIKey | JLPRHGASOBFTGC-KHYOSLBOSA-N |
| XLogP | 3.15 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |