C25H36N2O5 — CID 135101894
[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]methanone (PubChem CID 135101894) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is [(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]methanone.
| Compound Name | [(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 135101894 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | [(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]methanone |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(C(=O)C3CCN(C(=O)c4cc(OC)cc(OC)c4)CC3)C[C@@H]21 |
| InChI | InChI=1S/C25H36N2O5/c1-4-25(30)9-5-6-18-15-27(16-22(18)25)23(28)17-7-10-26(11-8-17)24(29)19-12-20(31-2)14-21(13-19)32-3/h12-14,17-18,22,30H,4-11,15-16H2,1-3H3/t18-,22+,25-/m1/s1 |
| InChIKey | GIAJBQWYQWNPRM-WSUBETFTSA-N |
| XLogP | 2.96 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |