C16H23N3O2 — CID 135088598
[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(5-methylpyrazin-2-yl)methanone (PubChem CID 135088598) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is [(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(5-methylpyrazin-2-yl)methanone.
| Compound Name | [(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 135088598 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(5-methylpyrazin-2-yl)methanone |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(C(=O)c3cnc(C)cn3)C[C@@H]21 |
| InChI | InChI=1S/C16H23N3O2/c1-3-16(21)6-4-5-12-9-19(10-13(12)16)15(20)14-8-17-11(2)7-18-14/h7-8,12-13,21H,3-6,9-10H2,1-2H3/t12-,13+,16-/m1/s1 |
| InChIKey | BMKQUDIKWVJIAY-DVOMOZLQSA-N |
| XLogP | 1.80 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |