C12H16N4O — CID 97377160
[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-(5-methylpyrazin-2-yl)methanone (PubChem CID 97377160) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is [(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-(5-methylpyrazin-2-yl)methanone.
| Compound Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 97377160 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-(5-methylpyrazin-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2C[C@H]3CCN[C@H]3C2)cn1 |
| InChI | InChI=1S/C12H16N4O/c1-8-4-15-10(5-14-8)12(17)16-6-9-2-3-13-11(9)7-16/h4-5,9,11,13H,2-3,6-7H2,1H3/t9-,11+/m1/s1 |
| InChIKey | NKEDEIMPFQWJJF-KOLCDFICSA-N |
| XLogP | 0.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |