C12H19ClN4O — CID 155836066
[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5-methyl-1H-pyrazol-3-yl)methanone;hydrochloride (PubChem CID 155836066) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is [(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5-methyl-1H-pyrazol-3-yl)methanone;hydrochloride.
| Compound Name | [(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5-methyl-1H-pyrazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 155836066 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5-methyl-1H-pyrazol-3-yl)methanone;hydrochloride |
| SMILES | Cc1cc(C(=O)N2C[C@H]3CCCN[C@H]3C2)n[nH]1.Cl |
| InChI | InChI=1S/C12H18N4O.ClH/c1-8-5-10(15-14-8)12(17)16-6-9-3-2-4-13-11(9)7-16;/h5,9,11,13H,2-4,6-7H2,1H3,(H,14,15);1H/t9-,11+;/m1./s1 |
| InChIKey | RMNJYEIUSZHLGO-XQKZEKTMSA-N |
| XLogP | 0.96 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |