C14H22N4O — CID 102680126
1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(1,3,5-trimethylpyrazol-4-yl)methanone (PubChem CID 102680126) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(1,3,5-trimethylpyrazol-4-yl)methanone.
| Compound Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(1,3,5-trimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 102680126 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(1,3,5-trimethylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)c(C)c1C(=O)N1CC2CCCNC2C1 |
| InChI | InChI=1S/C14H22N4O/c1-9-13(10(2)17(3)16-9)14(19)18-7-11-5-4-6-15-12(11)8-18/h11-12,15H,4-8H2,1-3H3 |
| InChIKey | YAZRDLVXNYOXJP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |