C11H15N3O3 — CID 116681018
2-[1-(5-methyl-1H-pyrazole-3-carbonyl)azetidin-3-yl]propanoic acid (PubChem CID 116681018) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-[1-(5-methyl-1H-pyrazole-3-carbonyl)azetidin-3-yl]propanoic acid.
| Compound Name | 2-[1-(5-methyl-1H-pyrazole-3-carbonyl)azetidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 116681018 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[1-(5-methyl-1H-pyrazole-3-carbonyl)azetidin-3-yl]propanoic acid |
| SMILES | Cc1cc(C(=O)N2CC(C(C)C(=O)O)C2)n[nH]1 |
| InChI | InChI=1S/C11H15N3O3/c1-6-3-9(13-12-6)10(15)14-4-8(5-14)7(2)11(16)17/h3,7-8H,4-5H2,1-2H3,(H,12,13)(H,16,17) |
| InChIKey | KIVUOMDZJSYFFR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |