C13H21N5O — CID 102679903
[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)methanone (PubChem CID 102679903) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)methanone.
| Compound Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 102679903 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)methanone |
| SMILES | CC(C)c1nc(C(=O)N2C[C@@H]3CCCN[C@@H]3C2)n[nH]1 |
| InChI | InChI=1S/C13H21N5O/c1-8(2)11-15-12(17-16-11)13(19)18-6-9-4-3-5-14-10(9)7-18/h8-10,14H,3-7H2,1-2H3,(H,15,16,17)/t9-,10+/m0/s1 |
| InChIKey | ADLCMPBPIJUCMH-VHSXEESVSA-N |
| XLogP | 0.75 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |