C16H21N5O3 — CID 124799770
(2S,3aS,6aS)-1-acetyl-N-methyl-5-(5-methylpyrazine-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide (PubChem CID 124799770) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is (2S,3aS,6aS)-1-acetyl-N-methyl-5-(5-methylpyrazine-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide.
| Compound Name | (2S,3aS,6aS)-1-acetyl-N-methyl-5-(5-methylpyrazine-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 124799770 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (2S,3aS,6aS)-1-acetyl-N-methyl-5-(5-methylpyrazine-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@H]2CN(C(=O)c3cnc(C)cn3)C[C@H]2N1C(C)=O |
| InChI | InChI=1S/C16H21N5O3/c1-9-5-19-12(6-18-9)16(24)20-7-11-4-13(15(23)17-3)21(10(2)22)14(11)8-20/h5-6,11,13-14H,4,7-8H2,1-3H3,(H,17,23)/t11-,13-,14+/m0/s1 |
| InChIKey | JJXXVEUHESQPMD-FPMFFAJLSA-N |
| XLogP | -0.41 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |