C10H16N2O — CID 70649001
[(3aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-cyclopropylmethanone (PubChem CID 70649001) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is [(3aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-cyclopropylmethanone.
| Compound Name | [(3aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 70649001 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | [(3aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CC2NCC[C@@H]2C1 |
| InChI | InChI=1S/C10H16N2O/c13-10(7-1-2-7)12-5-8-3-4-11-9(8)6-12/h7-9,11H,1-6H2/t8-,9?/m1/s1 |
| InChIKey | BIUMDLRORBAEKH-VEDVMXKPSA-N |
| XLogP | 0.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |