C15H26N4O2 — CID 156607651
4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carbonyl)-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 156607651) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carbonyl)-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carbonyl)-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 156607651 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carbonyl)-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(C(=O)N2CC3CCNC3C2)CC1 |
| InChI | InChI=1S/C15H26N4O2/c1-17(2)15(21)18-7-4-11(5-8-18)14(20)19-9-12-3-6-16-13(12)10-19/h11-13,16H,3-10H2,1-2H3 |
| InChIKey | FUFGXHNLFSERQL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |